C30H38F2O4S2 — CID 18970720
1,4-difluoro-5,8-dihydroxy-2,3-bis(octylsulfanyl)anthracene-9,10-dione (PubChem CID 18970720) has the molecular formula C30H38F2O4S2 and a molecular weight of 564.76 g/mol. Its IUPAC name is 1,4-difluoro-5,8-dihydroxy-2,3-bis(octylsulfanyl)anthracene-9,10-dione.
| Compound Name | 1,4-difluoro-5,8-dihydroxy-2,3-bis(octylsulfanyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 18970720 |
| Molecular Formula | C30H38F2O4S2 |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 1,4-difluoro-5,8-dihydroxy-2,3-bis(octylsulfanyl)anthracene-9,10-dione |
| SMILES | CCCCCCCCSc1c(F)c2c(c(F)c1SCCCCCCCC)C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C30H38F2O4S2/c1-3-5-7-9-11-13-17-37-29-25(31)23-24(26(32)30(29)38-18-14-12-10-8-6-4-2)28(36)22-20(34)16-15-19(33)21(22)27(23)35/h15-16,33-34H,3-14,17-18H2,1-2H3 |
| InChIKey | QSBDOGOUWXHYCI-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|