C24H34O4S2 — CID 53240749
2-hexylsulfanyl-5-(4-hexylsulfanyl-2,5-dihydroxyphenyl)benzene-1,4-diol (PubChem CID 53240749) has the molecular formula C24H34O4S2 and a molecular weight of 450.67 g/mol. Its IUPAC name is 2-hexylsulfanyl-5-(4-hexylsulfanyl-2,5-dihydroxyphenyl)benzene-1,4-diol.
| Compound Name | 2-hexylsulfanyl-5-(4-hexylsulfanyl-2,5-dihydroxyphenyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 53240749 |
| Molecular Formula | C24H34O4S2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 2-hexylsulfanyl-5-(4-hexylsulfanyl-2,5-dihydroxyphenyl)benzene-1,4-diol |
| SMILES | CCCCCCSc1cc(O)c(-c2cc(O)c(SCCCCCC)cc2O)cc1O |
| InChI | InChI=1S/C24H34O4S2/c1-3-5-7-9-11-29-23-15-19(25)17(13-21(23)27)18-14-22(28)24(16-20(18)26)30-12-10-8-6-4-2/h13-16,25-28H,3-12H2,1-2H3 |
| InChIKey | WTURUGGFVNGZMZ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|