C17H28OS — CID 66619666
2,6-dimethyl-4-nonylsulfanylphenol (PubChem CID 66619666) has the molecular formula C17H28OS and a molecular weight of 280.48 g/mol. Its IUPAC name is 2,6-dimethyl-4-nonylsulfanylphenol.
| Compound Name | 2,6-dimethyl-4-nonylsulfanylphenol |
|---|---|
| PubChem CID | 66619666 |
| Molecular Formula | C17H28OS |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 2,6-dimethyl-4-nonylsulfanylphenol |
| SMILES | CCCCCCCCCSc1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C17H28OS/c1-4-5-6-7-8-9-10-11-19-16-12-14(2)17(18)15(3)13-16/h12-13,18H,4-11H2,1-3H3 |
| InChIKey | SAPZGULJKZCSNK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|