C24H34O2 — CID 135345606
4-[1-(4-hydroxy-3,5-dimethylphenyl)octyl]-2,6-dimethylphenol (PubChem CID 135345606) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is 4-[1-(4-hydroxy-3,5-dimethylphenyl)octyl]-2,6-dimethylphenol.
| Compound Name | 4-[1-(4-hydroxy-3,5-dimethylphenyl)octyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 135345606 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 4-[1-(4-hydroxy-3,5-dimethylphenyl)octyl]-2,6-dimethylphenol |
| SMILES | CCCCCCCC(c1cc(C)c(O)c(C)c1)c1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C24H34O2/c1-6-7-8-9-10-11-22(20-12-16(2)23(25)17(3)13-20)21-14-18(4)24(26)19(5)15-21/h12-15,22,25-26H,6-11H2,1-5H3 |
| InChIKey | AQNZKAJEXXBFDT-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|