C37H44O4 — CID 10460281
2,6-dimethyl-4-[1,5,5-tris(4-hydroxy-3,5-dimethylphenyl)pentyl]phenol (PubChem CID 10460281) has the molecular formula C37H44O4 and a molecular weight of 552.76 g/mol. Its IUPAC name is 2,6-dimethyl-4-[1,5,5-tris(4-hydroxy-3,5-dimethylphenyl)pentyl]phenol.
| Compound Name | 2,6-dimethyl-4-[1,5,5-tris(4-hydroxy-3,5-dimethylphenyl)pentyl]phenol |
|---|---|
| PubChem CID | 10460281 |
| Molecular Formula | C37H44O4 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | 2,6-dimethyl-4-[1,5,5-tris(4-hydroxy-3,5-dimethylphenyl)pentyl]phenol |
| SMILES | Cc1cc(C(CCCC(c2cc(C)c(O)c(C)c2)c2cc(C)c(O)c(C)c2)c2cc(C)c(O)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C37H44O4/c1-20-12-28(13-21(2)34(20)38)32(29-14-22(3)35(39)23(4)15-29)10-9-11-33(30-16-24(5)36(40)25(6)17-30)31-18-26(7)37(41)27(8)19-31/h12-19,32-33,38-41H,9-11H2,1-8H3 |
| InChIKey | WIMVSGXYSQUBLG-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |