C44H42O2 — CID 139825043
4-[1-(4-hydroxy-3,5-diphenylphenyl)octyl]-2,6-diphenylphenol (PubChem CID 139825043) has the molecular formula C44H42O2 and a molecular weight of 602.82 g/mol. Its IUPAC name is 4-[1-(4-hydroxy-3,5-diphenylphenyl)octyl]-2,6-diphenylphenol.
| Compound Name | 4-[1-(4-hydroxy-3,5-diphenylphenyl)octyl]-2,6-diphenylphenol |
|---|---|
| PubChem CID | 139825043 |
| Molecular Formula | C44H42O2 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | 4-[1-(4-hydroxy-3,5-diphenylphenyl)octyl]-2,6-diphenylphenol |
| SMILES | CCCCCCCC(c1cc(-c2ccccc2)c(O)c(-c2ccccc2)c1)c1cc(-c2ccccc2)c(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C44H42O2/c1-2-3-4-5-18-27-38(36-28-39(32-19-10-6-11-20-32)43(45)40(29-36)33-21-12-7-13-22-33)37-30-41(34-23-14-8-15-24-34)44(46)42(31-37)35-25-16-9-17-26-35/h6-17,19-26,28-31,38,45-46H,2-5,18,27H2,1H3 |
| InChIKey | IOPKJQWDWWXRRR-UHFFFAOYSA-N |
| XLogP | 12.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|