C26H31NO — CID 22095865
4-(dibutylamino)-2,6-diphenylphenol (PubChem CID 22095865) has the molecular formula C26H31NO and a molecular weight of 373.54 g/mol. Its IUPAC name is 4-(dibutylamino)-2,6-diphenylphenol.
| Compound Name | 4-(dibutylamino)-2,6-diphenylphenol |
|---|---|
| PubChem CID | 22095865 |
| Molecular Formula | C26H31NO |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 4-(dibutylamino)-2,6-diphenylphenol |
| SMILES | CCCCN(CCCC)c1cc(-c2ccccc2)c(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H31NO/c1-3-5-17-27(18-6-4-2)23-19-24(21-13-9-7-10-14-21)26(28)25(20-23)22-15-11-8-12-16-22/h7-16,19-20,28H,3-6,17-18H2,1-2H3 |
| InChIKey | DUEYWAKXHSNVMM-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |