C22H22OS — CID 66619517
4-butylsulfanyl-2,6-diphenylphenol (PubChem CID 66619517) has the molecular formula C22H22OS and a molecular weight of 334.48 g/mol. Its IUPAC name is 4-butylsulfanyl-2,6-diphenylphenol.
| Compound Name | 4-butylsulfanyl-2,6-diphenylphenol |
|---|---|
| PubChem CID | 66619517 |
| Molecular Formula | C22H22OS |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-butylsulfanyl-2,6-diphenylphenol |
| SMILES | CCCCSc1cc(-c2ccccc2)c(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H22OS/c1-2-3-14-24-19-15-20(17-10-6-4-7-11-17)22(23)21(16-19)18-12-8-5-9-13-18/h4-13,15-16,23H,2-3,14H2,1H3 |
| InChIKey | OATWSOWUSLJSPZ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|