C38H30O2 — CID 139825093
4-[1-(4-hydroxy-3,5-diphenylphenyl)ethyl]-2,6-diphenylphenol (PubChem CID 139825093) has the molecular formula C38H30O2 and a molecular weight of 518.66 g/mol. Its IUPAC name is 4-[1-(4-hydroxy-3,5-diphenylphenyl)ethyl]-2,6-diphenylphenol.
| Compound Name | 4-[1-(4-hydroxy-3,5-diphenylphenyl)ethyl]-2,6-diphenylphenol |
|---|---|
| PubChem CID | 139825093 |
| Molecular Formula | C38H30O2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 4-[1-(4-hydroxy-3,5-diphenylphenyl)ethyl]-2,6-diphenylphenol |
| SMILES | CC(c1cc(-c2ccccc2)c(O)c(-c2ccccc2)c1)c1cc(-c2ccccc2)c(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C38H30O2/c1-26(31-22-33(27-14-6-2-7-15-27)37(39)34(23-31)28-16-8-3-9-17-28)32-24-35(29-18-10-4-11-19-29)38(40)36(25-32)30-20-12-5-13-21-30/h2-26,39-40H,1H3 |
| InChIKey | QCYTUXYQNUOCBQ-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |