C21H21NO — CID 15625757
4-[(dimethylamino)methyl]-2,6-diphenylphenol (PubChem CID 15625757) has the molecular formula C21H21NO and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-2,6-diphenylphenol.
| Compound Name | 4-[(dimethylamino)methyl]-2,6-diphenylphenol |
|---|---|
| PubChem CID | 15625757 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 4-[(dimethylamino)methyl]-2,6-diphenylphenol |
| SMILES | CN(C)Cc1cc(-c2ccccc2)c(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H21NO/c1-22(2)15-16-13-19(17-9-5-3-6-10-17)21(23)20(14-16)18-11-7-4-8-12-18/h3-14,23H,15H2,1-2H3 |
| InChIKey | RXXGPXQJRRGRJP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |