C9H14BrN — CID 71398520
N,N-dimethyl-1-phenylmethanamine;hydrobromide (PubChem CID 71398520) has the molecular formula C9H14BrN and a molecular weight of 216.12 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylmethanamine;hydrobromide.
| Compound Name | N,N-dimethyl-1-phenylmethanamine;hydrobromide |
|---|---|
| PubChem CID | 71398520 |
| Molecular Formula | C9H14BrN |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | N,N-dimethyl-1-phenylmethanamine;hydrobromide |
| SMILES | Br.CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C9H13N.BrH/c1-10(2)8-9-6-4-3-5-7-9;/h3-7H,8H2,1-2H3;1H |
| InChIKey | NULGSOGHGHDGBH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |