C50H54O2 — CID 71369615
4-[1-[4-hydroxy-3,5-bis(1-phenylpropyl)phenyl]ethyl]-2,6-bis(1-phenylpropyl)phenol (PubChem CID 71369615) has the molecular formula C50H54O2 and a molecular weight of 686.98 g/mol. Its IUPAC name is 4-[1-[4-hydroxy-3,5-bis(1-phenylpropyl)phenyl]ethyl]-2,6-bis(1-phenylpropyl)phenol.
| Compound Name | 4-[1-[4-hydroxy-3,5-bis(1-phenylpropyl)phenyl]ethyl]-2,6-bis(1-phenylpropyl)phenol |
|---|---|
| PubChem CID | 71369615 |
| Molecular Formula | C50H54O2 |
| Molecular Weight | 686.98 g/mol |
| Exact Mass | 686.41 |
| IUPAC Name | 4-[1-[4-hydroxy-3,5-bis(1-phenylpropyl)phenyl]ethyl]-2,6-bis(1-phenylpropyl)phenol |
| SMILES | CCC(c1ccccc1)c1cc(C(C)c2cc(C(CC)c3ccccc3)c(O)c(C(CC)c3ccccc3)c2)cc(C(CC)c2ccccc2)c1O |
| InChI | InChI=1S/C50H54O2/c1-6-41(35-22-14-10-15-23-35)45-30-39(31-46(49(45)51)42(7-2)36-24-16-11-17-25-36)34(5)40-32-47(43(8-3)37-26-18-12-19-27-37)50(52)48(33-40)44(9-4)38-28-20-13-21-29-38/h10-34,41-44,51-52H,6-9H2,1-5H3 |
| InChIKey | GHRJSRQTBOEVJA-UHFFFAOYSA-N |
| XLogP | 13.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.98 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |