C26H30O — CID 23045364
4-(2-methylpropyl)-2,6-bis(1-phenylethyl)phenol (PubChem CID 23045364) has the molecular formula C26H30O and a molecular weight of 358.52 g/mol. Its IUPAC name is 4-(2-methylpropyl)-2,6-bis(1-phenylethyl)phenol.
| Compound Name | 4-(2-methylpropyl)-2,6-bis(1-phenylethyl)phenol |
|---|---|
| PubChem CID | 23045364 |
| Molecular Formula | C26H30O |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 4-(2-methylpropyl)-2,6-bis(1-phenylethyl)phenol |
| SMILES | CC(C)Cc1cc(C(C)c2ccccc2)c(O)c(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C26H30O/c1-18(2)15-21-16-24(19(3)22-11-7-5-8-12-22)26(27)25(17-21)20(4)23-13-9-6-10-14-23/h5-14,16-20,27H,15H2,1-4H3 |
| InChIKey | MCMZFVHHWRHNRJ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |