About 3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol
3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol (PubChem CID 90085264) has the molecular formula C26H30O
and a molecular weight of 358.52 g/mol. Its IUPAC name is 3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol.
Molecular Properties
| Compound Name | 3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol |
| PubChem CID | 90085264 |
| Molecular Formula | C26H30O |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol |
| SMILES | Cc1c(C(C)C)cc(C(C)c2ccccc2)c(O)c1C(C)c1ccccc1 |
| InChI | InChI=1S/C26H30O/c1-17(2)23-16-24(18(3)21-12-8-6-9-13-21)26(27)25(20(23)5)19(4)22-14-10-7-11-15-22/h6-19,27H,1-5H3 |
| InChIKey | JJVMEQZJHWGUGY-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol?
The IUPAC name of 3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol (CID 90085264) is 3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol.
What is the SMILES notation for 3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol?
The canonical SMILES for 3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol is Cc1c(C(C)C)cc(C(C)c2ccccc2)c(O)c1C(C)c1ccccc1.
What is the InChIKey of 3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol?
The InChIKey is JJVMEQZJHWGUGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30O/c1-17(2)23-16-24(18(3)21-12-8-6-9-13-21)26(27)25(20(23)5)19(4)22-14-10-7-11-15-22/h6-19,27H,1-5H3.
What are the key properties of 3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol?
3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol has a molecular weight of 358.52 g/mol, XLogP of 7.13, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,6-bis(1-phenylethyl)-4-propan-2-ylphenol is sourced from PubChem (CID 90085264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).