C19H24 — CID 54426646
1,2,3,4,5-pentamethyl-6-(1-phenylethyl)benzene (PubChem CID 54426646) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-6-(1-phenylethyl)benzene.
| Compound Name | 1,2,3,4,5-pentamethyl-6-(1-phenylethyl)benzene |
|---|---|
| PubChem CID | 54426646 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-6-(1-phenylethyl)benzene |
| SMILES | Cc1c(C)c(C)c(C(C)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C19H24/c1-12-13(2)15(4)19(16(5)14(12)3)17(6)18-10-8-7-9-11-18/h7-11,17H,1-6H3 |
| InChIKey | LLHYFFYZGZHFIG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |