C27H30N2 — CID 175203205
1-[3,4,5-trimethyl-2,6-bis[(1R)-1-phenylethyl]phenyl]ethane-1,2-diimine (PubChem CID 175203205) has the molecular formula C27H30N2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-[3,4,5-trimethyl-2,6-bis[(1R)-1-phenylethyl]phenyl]ethane-1,2-diimine.
| Compound Name | 1-[3,4,5-trimethyl-2,6-bis[(1R)-1-phenylethyl]phenyl]ethane-1,2-diimine |
|---|---|
| PubChem CID | 175203205 |
| Molecular Formula | C27H30N2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 1-[3,4,5-trimethyl-2,6-bis[(1R)-1-phenylethyl]phenyl]ethane-1,2-diimine |
| SMILES | [H]/N=C(\C=N\[H])c1c([C@H](C)c2ccccc2)c(C)c(C)c(C)c1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C27H30N2/c1-17-18(2)25(20(4)22-12-8-6-9-13-22)27(24(29)16-28)26(19(17)3)21(5)23-14-10-7-11-15-23/h6-16,20-21,28-29H,1-5H3/b28-16+,29-24+/t20-,21-/m1/s1 |
| InChIKey | ULCISYCDXQRUEK-KKKJRDNBSA-N |
| XLogP | 6.93 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|