C16H18O — CID 44719973
2,5-dimethyl-4-(1-phenylethyl)phenol (PubChem CID 44719973) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 2,5-dimethyl-4-(1-phenylethyl)phenol.
| Compound Name | 2,5-dimethyl-4-(1-phenylethyl)phenol |
|---|---|
| PubChem CID | 44719973 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 2,5-dimethyl-4-(1-phenylethyl)phenol |
| SMILES | Cc1cc(C(C)c2ccccc2)c(C)cc1O |
| InChI | InChI=1S/C16H18O/c1-11-10-16(17)12(2)9-15(11)13(3)14-7-5-4-6-8-14/h4-10,13,17H,1-3H3 |
| InChIKey | MNIKCWJNXKVZEU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |