C19H24O2 — CID 22571327
4-[1-(4-hydroxy-2,5-dimethylphenyl)propyl]-2,5-dimethylphenol (PubChem CID 22571327) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 4-[1-(4-hydroxy-2,5-dimethylphenyl)propyl]-2,5-dimethylphenol.
| Compound Name | 4-[1-(4-hydroxy-2,5-dimethylphenyl)propyl]-2,5-dimethylphenol |
|---|---|
| PubChem CID | 22571327 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 4-[1-(4-hydroxy-2,5-dimethylphenyl)propyl]-2,5-dimethylphenol |
| SMILES | CCC(c1cc(C)c(O)cc1C)c1cc(C)c(O)cc1C |
| InChI | InChI=1S/C19H24O2/c1-6-15(16-7-13(4)18(20)9-11(16)2)17-8-14(5)19(21)10-12(17)3/h7-10,15,20-21H,6H2,1-5H3 |
| InChIKey | WKHISMNFYNDMLP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |