C11H15NO — CID 130612517
4-[(1R)-1-aminoprop-2-enyl]-2,5-dimethylphenol (PubChem CID 130612517) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-[(1R)-1-aminoprop-2-enyl]-2,5-dimethylphenol.
| Compound Name | 4-[(1R)-1-aminoprop-2-enyl]-2,5-dimethylphenol |
|---|---|
| PubChem CID | 130612517 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 4-[(1R)-1-aminoprop-2-enyl]-2,5-dimethylphenol |
| SMILES | C=C[C@@H](N)c1cc(C)c(O)cc1C |
| InChI | InChI=1S/C11H15NO/c1-4-10(12)9-5-8(3)11(13)6-7(9)2/h4-6,10,13H,1,12H2,2-3H3/t10-/m1/s1 |
| InChIKey | CXYUWAMKWAVLFX-SNVBAGLBSA-N |
| XLogP | 2.19 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|