C11H16N2 — CID 55282340
2-(1-aminoprop-2-enyl)-4,6-dimethylaniline (PubChem CID 55282340) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-(1-aminoprop-2-enyl)-4,6-dimethylaniline.
| Compound Name | 2-(1-aminoprop-2-enyl)-4,6-dimethylaniline |
|---|---|
| PubChem CID | 55282340 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-(1-aminoprop-2-enyl)-4,6-dimethylaniline |
| SMILES | C=CC(N)c1cc(C)cc(C)c1N |
| InChI | InChI=1S/C11H16N2/c1-4-10(12)9-6-7(2)5-8(3)11(9)13/h4-6,10H,1,12-13H2,2-3H3 |
| InChIKey | BCJNIRBEKUSVBY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|