C21H21NO2 — CID 171481741
4-[(2-amino-3,5-dimethylphenyl)-(4-hydroxyphenyl)methyl]phenol (PubChem CID 171481741) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 4-[(2-amino-3,5-dimethylphenyl)-(4-hydroxyphenyl)methyl]phenol.
| Compound Name | 4-[(2-amino-3,5-dimethylphenyl)-(4-hydroxyphenyl)methyl]phenol |
|---|---|
| PubChem CID | 171481741 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 4-[(2-amino-3,5-dimethylphenyl)-(4-hydroxyphenyl)methyl]phenol |
| SMILES | Cc1cc(C)c(N)c(C(c2ccc(O)cc2)c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C21H21NO2/c1-13-11-14(2)21(22)19(12-13)20(15-3-7-17(23)8-4-15)16-5-9-18(24)10-6-16/h3-12,20,23-24H,22H2,1-2H3 |
| InChIKey | NTKFIWXVXOURPQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|