C15H17NO — CID 799505
(S)-(2-amino-3,5-dimethylphenyl)-phenylmethanol (PubChem CID 799505) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is (S)-(2-amino-3,5-dimethylphenyl)-phenylmethanol.
| Compound Name | (S)-(2-amino-3,5-dimethylphenyl)-phenylmethanol |
|---|---|
| PubChem CID | 799505 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (S)-(2-amino-3,5-dimethylphenyl)-phenylmethanol |
| SMILES | Cc1cc(C)c(N)c([C@@H](O)c2ccccc2)c1 |
| InChI | InChI=1S/C15H17NO/c1-10-8-11(2)14(16)13(9-10)15(17)12-6-4-3-5-7-12/h3-9,15,17H,16H2,1-2H3/t15-/m0/s1 |
| InChIKey | CZONEUUVGUPQSP-HNNXBMFYSA-N |
| XLogP | 2.97 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|