C15H13F3O — CID 102751287
[2-methyl-4-(trifluoromethyl)phenyl]-phenylmethanol (PubChem CID 102751287) has the molecular formula C15H13F3O and a molecular weight of 266.26 g/mol. Its IUPAC name is [2-methyl-4-(trifluoromethyl)phenyl]-phenylmethanol.
| Compound Name | [2-methyl-4-(trifluoromethyl)phenyl]-phenylmethanol |
|---|---|
| PubChem CID | 102751287 |
| Molecular Formula | C15H13F3O |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [2-methyl-4-(trifluoromethyl)phenyl]-phenylmethanol |
| SMILES | Cc1cc(C(F)(F)F)ccc1C(O)c1ccccc1 |
| InChI | InChI=1S/C15H13F3O/c1-10-9-12(15(16,17)18)7-8-13(10)14(19)11-5-3-2-4-6-11/h2-9,14,19H,1H3 |
| InChIKey | XGHYUKYIIAWTJD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |