C16H14F4O — CID 102751473
(4-fluoro-3-methylphenyl)-[2-methyl-4-(trifluoromethyl)phenyl]methanol (PubChem CID 102751473) has the molecular formula C16H14F4O and a molecular weight of 298.28 g/mol. Its IUPAC name is (4-fluoro-3-methylphenyl)-[2-methyl-4-(trifluoromethyl)phenyl]methanol.
| Compound Name | (4-fluoro-3-methylphenyl)-[2-methyl-4-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 102751473 |
| Molecular Formula | C16H14F4O |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (4-fluoro-3-methylphenyl)-[2-methyl-4-(trifluoromethyl)phenyl]methanol |
| SMILES | Cc1cc(C(O)c2ccc(C(F)(F)F)cc2C)ccc1F |
| InChI | InChI=1S/C16H14F4O/c1-9-8-12(16(18,19)20)4-5-13(9)15(21)11-3-6-14(17)10(2)7-11/h3-8,15,21H,1-2H3 |
| InChIKey | BSUVPDXOUDXQDX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |