C20H23ClF4 — CID 144880341
2-chloro-1-propan-2-yl-4-(trifluoromethyl)benzene;1-fluoro-2-methyl-4-propan-2-ylbenzene (PubChem CID 144880341) has the molecular formula C20H23ClF4 and a molecular weight of 374.85 g/mol. Its IUPAC name is 2-chloro-1-propan-2-yl-4-(trifluoromethyl)benzene;1-fluoro-2-methyl-4-propan-2-ylbenzene.
| Compound Name | 2-chloro-1-propan-2-yl-4-(trifluoromethyl)benzene;1-fluoro-2-methyl-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 144880341 |
| Molecular Formula | C20H23ClF4 |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-chloro-1-propan-2-yl-4-(trifluoromethyl)benzene;1-fluoro-2-methyl-4-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc(C(F)(F)F)cc1Cl.Cc1cc(C(C)C)ccc1F |
| InChI | InChI=1S/C10H10ClF3.C10H13F/c1-6(2)8-4-3-7(5-9(8)11)10(12,13)14;1-7(2)9-4-5-10(11)8(3)6-9/h3-6H,1-2H3;4-7H,1-3H3 |
| InChIKey | MSXBKRGJXRDNBU-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |