C46H50N2 — CID 162252807
4-methyl-2,6-bis(1-phenylethyl)aniline;4-methyl-2,6-bis[(1R)-1-phenylethyl]aniline (PubChem CID 162252807) has the molecular formula C46H50N2 and a molecular weight of 630.92 g/mol. Its IUPAC name is 4-methyl-2,6-bis(1-phenylethyl)aniline;4-methyl-2,6-bis[(1R)-1-phenylethyl]aniline.
| Compound Name | 4-methyl-2,6-bis(1-phenylethyl)aniline;4-methyl-2,6-bis[(1R)-1-phenylethyl]aniline |
|---|---|
| PubChem CID | 162252807 |
| Molecular Formula | C46H50N2 |
| Molecular Weight | 630.92 g/mol |
| Exact Mass | 630.40 |
| IUPAC Name | 4-methyl-2,6-bis(1-phenylethyl)aniline;4-methyl-2,6-bis[(1R)-1-phenylethyl]aniline |
| SMILES | Cc1cc(C(C)c2ccccc2)c(N)c(C(C)c2ccccc2)c1.Cc1cc([C@H](C)c2ccccc2)c(N)c([C@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/2C23H25N/c2*1-16-14-21(17(2)19-10-6-4-7-11-19)23(24)22(15-16)18(3)20-12-8-5-9-13-20/h2*4-15,17-18H,24H2,1-3H3/t17-,18-;/m1./s1 |
| InChIKey | ZYFBPBHHUGKBHS-JAXOOIEVSA-N |
| XLogP | 11.76 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.92 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|