C29H37N — CID 101374457
4-methyl-6-[(1S)-1-(2,4,6-trimethylphenyl)ethyl]-2-[(1R)-1-(2,4,6-trimethylphenyl)ethyl]aniline (PubChem CID 101374457) has the molecular formula C29H37N and a molecular weight of 399.62 g/mol. Its IUPAC name is 4-methyl-6-[(1S)-1-(2,4,6-trimethylphenyl)ethyl]-2-[(1R)-1-(2,4,6-trimethylphenyl)ethyl]aniline.
| Compound Name | 4-methyl-6-[(1S)-1-(2,4,6-trimethylphenyl)ethyl]-2-[(1R)-1-(2,4,6-trimethylphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 101374457 |
| Molecular Formula | C29H37N |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | 4-methyl-6-[(1S)-1-(2,4,6-trimethylphenyl)ethyl]-2-[(1R)-1-(2,4,6-trimethylphenyl)ethyl]aniline |
| SMILES | Cc1cc(C)c([C@H](C)c2cc(C)cc([C@H](C)c3c(C)cc(C)cc3C)c2N)c(C)c1 |
| InChI | InChI=1S/C29H37N/c1-16-10-19(4)27(20(5)11-16)23(8)25-14-18(3)15-26(29(25)30)24(9)28-21(6)12-17(2)13-22(28)7/h10-15,23-24H,30H2,1-9H3/t23-,24+ |
| InChIKey | QNTQZNQTDGAVIJ-PSWAGMNNSA-N |
| XLogP | 7.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|