C51H54N2 — CID 178184490
4,5-dimethyl-1,3-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]-2H-imidazole (PubChem CID 178184490) has the molecular formula C51H54N2 and a molecular weight of 695.01 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]-2H-imidazole.
| Compound Name | 4,5-dimethyl-1,3-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]-2H-imidazole |
|---|---|
| PubChem CID | 178184490 |
| Molecular Formula | C51H54N2 |
| Molecular Weight | 695.01 g/mol |
| Exact Mass | 694.43 |
| IUPAC Name | 4,5-dimethyl-1,3-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]-2H-imidazole |
| SMILES | CC1=C(C)N(c2c([C@@H](C)c3ccccc3)cc(C)cc2[C@@H](C)c2ccccc2)CN1c1c([C@@H](C)c2ccccc2)cc(C)cc1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C51H54N2/c1-34-29-46(36(3)42-21-13-9-14-22-42)50(47(30-34)37(4)43-23-15-10-16-24-43)52-33-53(41(8)40(52)7)51-48(38(5)44-25-17-11-18-26-44)31-35(2)32-49(51)39(6)45-27-19-12-20-28-45/h9-32,36-39H,33H2,1-8H3/t36-,37-,38-,39-/m0/s1 |
| InChIKey | WPEQJMXPXILVNW-GTKRZRNESA-N |
| XLogP | 13.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.01 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |