About 1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine
1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine (PubChem CID 175206372) has the molecular formula C49H52N2O2
and a molecular weight of 700.97 g/mol. Its IUPAC name is 1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine.
Molecular Properties
| Compound Name | 1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine |
| PubChem CID | 175206372 |
| Molecular Formula | C49H52N2O2 |
| Molecular Weight | 700.97 g/mol |
| Exact Mass | 700.40 |
| IUPAC Name | 1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine |
| SMILES | COc1cc(C(C)c2ccccc2)c(N2CCN(c3c(C(C)c4ccccc4)cc(OC)cc3C(C)c3ccccc3)C2)c(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C49H52N2O2/c1-34(38-19-11-7-12-20-38)44-29-42(52-5)30-45(35(2)39-21-13-8-14-22-39)48(44)50-27-28-51(33-50)49-46(36(3)40-23-15-9-16-24-40)31-43(53-6)32-47(49)37(4)41-25-17-10-18-26-41/h7-26,29-32,34-37H,27-28,33H2,1-6H3 |
| InChIKey | UDYNXEJAQPOEEF-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 700.97 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine?
The IUPAC name of 1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine (CID 175206372) is 1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine.
What is the SMILES notation for 1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine?
The canonical SMILES for 1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine is COc1cc(C(C)c2ccccc2)c(N2CCN(c3c(C(C)c4ccccc4)cc(OC)cc3C(C)c3ccccc3)C2)c(C(C)c2ccccc2)c1.
What is the InChIKey of 1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine?
The InChIKey is UDYNXEJAQPOEEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C49H52N2O2/c1-34(38-19-11-7-12-20-38)44-29-42(52-5)30-45(35(2)39-21-13-8-14-22-39)48(44)50-27-28-51(33-50)49-46(36(3)40-23-15-9-16-24-40)31-43(53-6)32-47(49)37(4)41-25-17-10-18-26-41/h7-26,29-32,34-37H,27-28,33H2,1-6H3.
What are the key properties of 1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine?
1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine has a molecular weight of 700.97 g/mol, XLogP of 11.60, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[4-methoxy-2,6-bis(1-phenylethyl)phenyl]imidazolidine is sourced from PubChem (CID 175206372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).