C49H52N2O2 — CID 161065401
1,3-bis[4-methoxy-2,6-bis[(1R)-1-phenylethyl]phenyl]imidazolidine (PubChem CID 161065401) has the molecular formula C49H52N2O2 and a molecular weight of 700.97 g/mol. Its IUPAC name is 1,3-bis[4-methoxy-2,6-bis[(1R)-1-phenylethyl]phenyl]imidazolidine.
| Compound Name | 1,3-bis[4-methoxy-2,6-bis[(1R)-1-phenylethyl]phenyl]imidazolidine |
|---|---|
| PubChem CID | 161065401 |
| Molecular Formula | C49H52N2O2 |
| Molecular Weight | 700.97 g/mol |
| Exact Mass | 700.40 |
| IUPAC Name | 1,3-bis[4-methoxy-2,6-bis[(1R)-1-phenylethyl]phenyl]imidazolidine |
| SMILES | COc1cc([C@H](C)c2ccccc2)c(N2CCN(c3c([C@H](C)c4ccccc4)cc(OC)cc3[C@H](C)c3ccccc3)C2)c([C@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C49H52N2O2/c1-34(38-19-11-7-12-20-38)44-29-42(52-5)30-45(35(2)39-21-13-8-14-22-39)48(44)50-27-28-51(33-50)49-46(36(3)40-23-15-9-16-24-40)31-43(53-6)32-47(49)37(4)41-25-17-10-18-26-41/h7-26,29-32,34-37H,27-28,33H2,1-6H3/t34-,35-,36-,37-/m1/s1 |
| InChIKey | UDYNXEJAQPOEEF-LPYGTTGFSA-N |
| XLogP | 11.60 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.97 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|