C59H54N2 — CID 178184512
7,9-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]-8H-acenaphthyleno[1,2-d]imidazole (PubChem CID 178184512) has the molecular formula C59H54N2 and a molecular weight of 791.10 g/mol. Its IUPAC name is 7,9-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]-8H-acenaphthyleno[1,2-d]imidazole.
| Compound Name | 7,9-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]-8H-acenaphthyleno[1,2-d]imidazole |
|---|---|
| PubChem CID | 178184512 |
| Molecular Formula | C59H54N2 |
| Molecular Weight | 791.10 g/mol |
| Exact Mass | 790.43 |
| IUPAC Name | 7,9-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]-8H-acenaphthyleno[1,2-d]imidazole |
| SMILES | Cc1cc([C@@H](C)c2ccccc2)c(N2CN(c3c([C@@H](C)c4ccccc4)cc(C)cc3[C@@H](C)c3ccccc3)C3=C2c2cccc4cccc3c24)c([C@@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C59H54N2/c1-38-33-51(40(3)44-21-11-7-12-22-44)56(52(34-38)41(4)45-23-13-8-14-24-45)60-37-61(59-50-32-20-30-48-29-19-31-49(55(48)50)58(59)60)57-53(42(5)46-25-15-9-16-26-46)35-39(2)36-54(57)43(6)47-27-17-10-18-28-47/h7-36,40-43H,37H2,1-6H3/t40-,41-,42-,43-/m0/s1 |
| InChIKey | STEBCGLWTMRYEO-MXGQMUSSSA-N |
| XLogP | 15.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.10 |
| LogP ≤ 5 | 15.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |