C49H49ClN2 — CID 54577259
1,3-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]imidazol-1-ium chloride (PubChem CID 54577259) has the molecular formula C49H49ClN2 and a molecular weight of 701.40 g/mol. Its IUPAC name is 1,3-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]imidazol-1-ium chloride.
| Compound Name | 1,3-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]imidazol-1-ium chloride |
|---|---|
| PubChem CID | 54577259 |
| Molecular Formula | C49H49ClN2 |
| Molecular Weight | 701.40 g/mol |
| Exact Mass | 700.36 |
| IUPAC Name | 1,3-bis[4-methyl-2,6-bis[(1S)-1-phenylethyl]phenyl]imidazol-1-ium chloride |
| SMILES | Cc1cc([C@@H](C)c2ccccc2)c(-n2cc[n+](-c3c([C@@H](C)c4ccccc4)cc(C)cc3[C@@H](C)c3ccccc3)c2)c([C@@H](C)c2ccccc2)c1.[Cl-] |
| InChI | InChI=1S/C49H49N2.ClH/c1-34-29-44(36(3)40-19-11-7-12-20-40)48(45(30-34)37(4)41-21-13-8-14-22-41)50-27-28-51(33-50)49-46(38(5)42-23-15-9-16-24-42)31-35(2)32-47(49)39(6)43-25-17-10-18-26-43;/h7-33,36-39H,1-6H3;1H/q+1;/p-1/t36-,37-,38-,39-;/m0./s1 |
| InChIKey | BDTBYZMZPGQUSA-WCSBEQOWSA-M |
| XLogP | 8.98 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.40 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|