C45H41N2+ — CID 132596566
1,3-bis(2-benzhydryl-4,6-dimethylphenyl)imidazol-1-ium (PubChem CID 132596566) has the molecular formula C45H41N2+ and a molecular weight of 609.84 g/mol. Its IUPAC name is 1,3-bis(2-benzhydryl-4,6-dimethylphenyl)imidazol-1-ium.
| Compound Name | 1,3-bis(2-benzhydryl-4,6-dimethylphenyl)imidazol-1-ium |
|---|---|
| PubChem CID | 132596566 |
| Molecular Formula | C45H41N2+ |
| Molecular Weight | 609.84 g/mol |
| Exact Mass | 609.33 |
| IUPAC Name | 1,3-bis(2-benzhydryl-4,6-dimethylphenyl)imidazol-1-ium |
| SMILES | Cc1cc(C)c(-n2cc[n+](-c3c(C)cc(C)cc3C(c3ccccc3)c3ccccc3)c2)c(C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C45H41N2/c1-32-27-34(3)44(40(29-32)42(36-17-9-5-10-18-36)37-19-11-6-12-20-37)46-25-26-47(31-46)45-35(4)28-33(2)30-41(45)43(38-21-13-7-14-22-38)39-23-15-8-16-24-39/h5-31,42-43H,1-4H3/q+1 |
| InChIKey | GVUPYABHKFSCTC-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.84 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|