About CID 166445578
CID 166445578 (PubChem CID 166445578) has the molecular formula C72H61ClN2Ni
and a molecular weight of 1048.44 g/mol.
Molecular Properties
| Compound Name | CID 166445578 |
| PubChem CID | 166445578 |
| Molecular Formula | C72H61ClN2Ni |
| Molecular Weight | 1048.44 g/mol |
| Exact Mass | 1046.39 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(c2ccccc2)c2ccccc2)c(-n2ccn(-c3c(C(c4ccccc4)c4ccccc4)cc(C)cc3C(c3ccccc3)c3ccccc3)c2=[Ni]Cl)c(C(c2ccccc2)c2ccccc2)c1.[CH2]C=C |
| InChI | InChI=1S/C69H56N2.C3H5.ClH.Ni/c1-50-45-60(64(52-27-11-3-12-28-52)53-29-13-4-14-30-53)68(61(46-50)65(54-31-15-5-16-32-54)55-33-17-6-18-34-55)70-43-44-71(49-70)69-62(66(56-35-19-7-20-36-56)57-37-21-8-22-38-57)47-51(2)48-63(69)67(58-39-23-9-24-40-58)59-41-25-10-26-42-59;1-3-2;;/h3-48,64-67H,1-2H3;3H,1-2H2;1H;/q;;;+1/p-1 |
| InChIKey | FACUHZBQUKYJHA-UHFFFAOYSA-M |
| XLogP | 18.38 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 76 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1048.44 |
| LogP ≤ 5 | 18.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 166445578 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166445578?
The IUPAC name of CID 166445578 (CID 166445578) is not available.
What is the SMILES notation for CID 166445578?
The canonical SMILES for CID 166445578 is Cc1cc(C(c2ccccc2)c2ccccc2)c(-n2ccn(-c3c(C(c4ccccc4)c4ccccc4)cc(C)cc3C(c3ccccc3)c3ccccc3)c2=[Ni]Cl)c(C(c2ccccc2)c2ccccc2)c1.[CH2]C=C.
What is the InChIKey of CID 166445578?
The InChIKey is FACUHZBQUKYJHA-UHFFFAOYSA-M. The full InChI is InChI=1S/C69H56N2.C3H5.ClH.Ni/c1-50-45-60(64(52-27-11-3-12-28-52)53-29-13-4-14-30-53)68(61(46-50)65(54-31-15-5-16-32-54)55-33-17-6-18-34-55)70-43-44-71(49-70)69-62(66(56-35-19-7-20-36-56)57-37-21-8-22-38-57)47-51(2)48-63(69)67(58-39-23-9-24-40-58)59-41-25-10-26-42-59;1-3-2;;/h3-48,64-67H,1-2H3;3H,1-2H2;1H;/q;;;+1/p-1.
What are the key properties of CID 166445578?
CID 166445578 has a molecular weight of 1048.44 g/mol, XLogP of 18.38, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166445578 is sourced from PubChem (CID 166445578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).