C72H61ClN2Ni — CID 166445578
CID 166445578 (PubChem CID 166445578) has the molecular formula C72H61ClN2Ni and a molecular weight of 1048.44 g/mol.
| Compound Name | CID 166445578 |
|---|---|
| PubChem CID | 166445578 |
| Molecular Formula | C72H61ClN2Ni |
| Molecular Weight | 1048.44 g/mol |
| Exact Mass | 1046.39 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(c2ccccc2)c2ccccc2)c(-n2ccn(-c3c(C(c4ccccc4)c4ccccc4)cc(C)cc3C(c3ccccc3)c3ccccc3)c2=[Ni]Cl)c(C(c2ccccc2)c2ccccc2)c1.[CH2]C=C |
| InChI | InChI=1S/C69H56N2.C3H5.ClH.Ni/c1-50-45-60(64(52-27-11-3-12-28-52)53-29-13-4-14-30-53)68(61(46-50)65(54-31-15-5-16-32-54)55-33-17-6-18-34-55)70-43-44-71(49-70)69-62(66(56-35-19-7-20-36-56)57-37-21-8-22-38-57)47-51(2)48-63(69)67(58-39-23-9-24-40-58)59-41-25-10-26-42-59;1-3-2;;/h3-48,64-67H,1-2H3;3H,1-2H2;1H;/q;;;+1/p-1 |
| InChIKey | FACUHZBQUKYJHA-UHFFFAOYSA-M |
| XLogP | 18.38 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1048.44 |
| LogP ≤ 5 | 18.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|