About 1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane
1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane (PubChem CID 145412167) has the molecular formula C25H30
and a molecular weight of 330.52 g/mol. Its IUPAC name is 1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane.
Molecular Properties
| Compound Name | 1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane |
| PubChem CID | 145412167 |
| Molecular Formula | C25H30 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane |
| SMILES | CC.Cc1cc(C)cc(C(c2ccccc2)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C23H24.C2H6/c1-16-10-17(2)13-21(12-16)23(20-8-6-5-7-9-20)22-14-18(3)11-19(4)15-22;1-2/h5-15,23H,1-4H3;1-2H3 |
| InChIKey | RCBQNFAYIVEZCQ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane?
The IUPAC name of 1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane (CID 145412167) is 1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane.
What is the SMILES notation for 1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane?
The canonical SMILES for 1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane is CC.Cc1cc(C)cc(C(c2ccccc2)c2cc(C)cc(C)c2)c1.
What is the InChIKey of 1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane?
The InChIKey is RCBQNFAYIVEZCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24.C2H6/c1-16-10-17(2)13-21(12-16)23(20-8-6-5-7-9-20)22-14-18(3)11-19(4)15-22;1-2/h5-15,23H,1-4H3;1-2H3.
What are the key properties of 1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane?
1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane has a molecular weight of 330.52 g/mol, XLogP of 7.13, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dimethylphenyl)-phenylmethyl]-3,5-dimethylbenzene;ethane is sourced from PubChem (CID 145412167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).