About lithium benzhydrylbenzene
lithium benzhydrylbenzene (PubChem CID 18381038) has the molecular formula C19H16Li+
and a molecular weight of 251.28 g/mol. Its IUPAC name is lithium benzhydrylbenzene.
Molecular Properties
| Compound Name | lithium benzhydrylbenzene |
| PubChem CID | 18381038 |
| Molecular Formula | C19H16Li+ |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | lithium benzhydrylbenzene |
| SMILES | [Li+].c1ccc(C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16.Li/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15,19H;/q;+1 |
| InChIKey | PRODOLUSLJVVMH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze lithium benzhydrylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium benzhydrylbenzene?
The IUPAC name of lithium benzhydrylbenzene (CID 18381038) is lithium benzhydrylbenzene.
What is the SMILES notation for lithium benzhydrylbenzene?
The canonical SMILES for lithium benzhydrylbenzene is [Li+].c1ccc(C(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of lithium benzhydrylbenzene?
The InChIKey is PRODOLUSLJVVMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16.Li/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15,19H;/q;+1.
What are the key properties of lithium benzhydrylbenzene?
lithium benzhydrylbenzene has a molecular weight of 251.28 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium benzhydrylbenzene is sourced from PubChem (CID 18381038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).