About benzhydrylbenzene triisocyanate
benzhydrylbenzene triisocyanate (PubChem CID 21225664) has the molecular formula C22H16N3O3-3
and a molecular weight of 370.39 g/mol. Its IUPAC name is benzhydrylbenzene triisocyanate.
Molecular Properties
| Compound Name | benzhydrylbenzene triisocyanate |
| PubChem CID | 21225664 |
| Molecular Formula | C22H16N3O3-3 |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | benzhydrylbenzene triisocyanate |
| SMILES | [N-]=C=O.[N-]=C=O.[N-]=C=O.c1ccc(C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16.3CNO/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3*2-1-3/h1-15,19H;;;/q;3*-1 |
| InChIKey | VRAUJXQSZQHFAZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 118.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze benzhydrylbenzene triisocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydrylbenzene triisocyanate?
The IUPAC name of benzhydrylbenzene triisocyanate (CID 21225664) is benzhydrylbenzene triisocyanate.
What is the SMILES notation for benzhydrylbenzene triisocyanate?
The canonical SMILES for benzhydrylbenzene triisocyanate is [N-]=C=O.[N-]=C=O.[N-]=C=O.c1ccc(C(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzhydrylbenzene triisocyanate?
The InChIKey is VRAUJXQSZQHFAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16.3CNO/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3*2-1-3/h1-15,19H;;;/q;3*-1.
What are the key properties of benzhydrylbenzene triisocyanate?
benzhydrylbenzene triisocyanate has a molecular weight of 370.39 g/mol, XLogP of 4.54, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydrylbenzene triisocyanate is sourced from PubChem (CID 21225664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).