About benzhydrylbenzene hexatetrafluoroborate
benzhydrylbenzene hexatetrafluoroborate (PubChem CID 173334521) has the molecular formula C19H16B6F24-6
and a molecular weight of 765.16 g/mol. Its IUPAC name is benzhydrylbenzene hexatetrafluoroborate.
Molecular Properties
| Compound Name | benzhydrylbenzene hexatetrafluoroborate |
| PubChem CID | 173334521 |
| Molecular Formula | C19H16B6F24-6 |
| Molecular Weight | 765.16 g/mol |
| Exact Mass | 766.15 |
| IUPAC Name | benzhydrylbenzene hexatetrafluoroborate |
| SMILES | F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.c1ccc(C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16.6BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;6*2-1(3,4)5/h1-15,19H;;;;;;/q;6*-1 |
| InChIKey | ZOFMVPVYQQAYEZ-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 765.16 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze benzhydrylbenzene hexatetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydrylbenzene hexatetrafluoroborate?
The IUPAC name of benzhydrylbenzene hexatetrafluoroborate (CID 173334521) is benzhydrylbenzene hexatetrafluoroborate.
What is the SMILES notation for benzhydrylbenzene hexatetrafluoroborate?
The canonical SMILES for benzhydrylbenzene hexatetrafluoroborate is F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.c1ccc(C(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzhydrylbenzene hexatetrafluoroborate?
The InChIKey is ZOFMVPVYQQAYEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16.6BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;6*2-1(3,4)5/h1-15,19H;;;;;;/q;6*-1.
What are the key properties of benzhydrylbenzene hexatetrafluoroborate?
benzhydrylbenzene hexatetrafluoroborate has a molecular weight of 765.16 g/mol, XLogP of 12.67, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydrylbenzene hexatetrafluoroborate is sourced from PubChem (CID 173334521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).