About 4-benzhydrylpyridine;ethane
4-benzhydrylpyridine;ethane (PubChem CID 90843990) has the molecular formula C22H27N
and a molecular weight of 305.47 g/mol. Its IUPAC name is 4-benzhydrylpyridine;ethane.
Molecular Properties
| Compound Name | 4-benzhydrylpyridine;ethane |
| PubChem CID | 90843990 |
| Molecular Formula | C22H27N |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 4-benzhydrylpyridine;ethane |
| SMILES | CC.CC.c1ccc(C(c2ccccc2)c2ccncc2)cc1 |
| InChI | InChI=1S/C18H15N.2C2H6/c1-3-7-15(8-4-1)18(16-9-5-2-6-10-16)17-11-13-19-14-12-17;2*1-2/h1-14,18H;2*1-2H3 |
| InChIKey | LBUZHLBEGKIYLZ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-benzhydrylpyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzhydrylpyridine;ethane?
The IUPAC name of 4-benzhydrylpyridine;ethane (CID 90843990) is 4-benzhydrylpyridine;ethane.
What is the SMILES notation for 4-benzhydrylpyridine;ethane?
The canonical SMILES for 4-benzhydrylpyridine;ethane is CC.CC.c1ccc(C(c2ccccc2)c2ccncc2)cc1.
What is the InChIKey of 4-benzhydrylpyridine;ethane?
The InChIKey is LBUZHLBEGKIYLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N.2C2H6/c1-3-7-15(8-4-1)18(16-9-5-2-6-10-16)17-11-13-19-14-12-17;2*1-2/h1-14,18H;2*1-2H3.
What are the key properties of 4-benzhydrylpyridine;ethane?
4-benzhydrylpyridine;ethane has a molecular weight of 305.47 g/mol, XLogP of 6.31, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzhydrylpyridine;ethane is sourced from PubChem (CID 90843990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).