C55H54N2Se — CID 169180747
2-(2,6-dibenzhydryl-4-methylphenyl)-5-[2,4,6-tri(propan-2-yl)phenyl]imidazo[1,5-a]pyridine-3-selone (PubChem CID 169180747) has the molecular formula C55H54N2Se and a molecular weight of 822.01 g/mol. Its IUPAC name is 2-(2,6-dibenzhydryl-4-methylphenyl)-5-[2,4,6-tri(propan-2-yl)phenyl]imidazo[1,5-a]pyridine-3-selone.
| Compound Name | 2-(2,6-dibenzhydryl-4-methylphenyl)-5-[2,4,6-tri(propan-2-yl)phenyl]imidazo[1,5-a]pyridine-3-selone |
|---|---|
| PubChem CID | 169180747 |
| Molecular Formula | C55H54N2Se |
| Molecular Weight | 822.01 g/mol |
| Exact Mass | 822.35 |
| IUPAC Name | 2-(2,6-dibenzhydryl-4-methylphenyl)-5-[2,4,6-tri(propan-2-yl)phenyl]imidazo[1,5-a]pyridine-3-selone |
| SMILES | Cc1cc(C(c2ccccc2)c2ccccc2)c(-n2cc3cccc(-c4c(C(C)C)cc(C(C)C)cc4C(C)C)n3c2=[Se])c(C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C55H54N2Se/c1-36(2)44-33-46(37(3)4)53(47(34-44)38(5)6)50-30-20-29-45-35-56(55(58)57(45)50)54-48(51(40-21-12-8-13-22-40)41-23-14-9-15-24-41)31-39(7)32-49(54)52(42-25-16-10-17-26-42)43-27-18-11-19-28-43/h8-38,51-52H,1-7H3 |
| InChIKey | AVPDJJRDJDHEIS-UHFFFAOYSA-N |
| XLogP | 14.14 |
| TPSA | 9.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.01 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|