C55H55ClCuN2 — CID 174057894
copper;2-(2,6-dibenzhydryl-4-methylphenyl)-5-[2,4,6-tri(propan-2-yl)phenyl]-3H-imidazo[1,5-a]pyridin-3-ide;chloride (PubChem CID 174057894) has the molecular formula C55H55ClCuN2 and a molecular weight of 843.06 g/mol. Its IUPAC name is copper;2-(2,6-dibenzhydryl-4-methylphenyl)-5-[2,4,6-tri(propan-2-yl)phenyl]-3H-imidazo[1,5-a]pyridin-3-ide;chloride.
| Compound Name | copper;2-(2,6-dibenzhydryl-4-methylphenyl)-5-[2,4,6-tri(propan-2-yl)phenyl]-3H-imidazo[1,5-a]pyridin-3-ide;chloride |
|---|---|
| PubChem CID | 174057894 |
| Molecular Formula | C55H55ClCuN2 |
| Molecular Weight | 843.06 g/mol |
| Exact Mass | 841.33 |
| IUPAC Name | copper;2-(2,6-dibenzhydryl-4-methylphenyl)-5-[2,4,6-tri(propan-2-yl)phenyl]-3H-imidazo[1,5-a]pyridin-3-ide;chloride |
| SMILES | Cc1cc(C(c2ccccc2)c2ccccc2)c(N2C=C3C=CC=C(c4c(C(C)C)cc(C(C)C)cc4C(C)C)N3[CH-]2)c(C(c2ccccc2)c2ccccc2)c1.[Cl-].[Cu+2] |
| InChI | InChI=1S/C55H55N2.ClH.Cu/c1-37(2)45-33-47(38(3)4)54(48(34-45)39(5)6)51-30-20-29-46-35-56(36-57(46)51)55-49(52(41-21-12-8-13-22-41)42-23-14-9-15-24-42)31-40(7)32-50(55)53(43-25-16-10-17-26-43)44-27-18-11-19-28-44;;/h8-39,52-53H,1-7H3;1H;/q-1;;+2/p-1 |
| InChIKey | JRYSSLNXPIHTFU-UHFFFAOYSA-M |
| XLogP | 11.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.06 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|