C33H36AuClN3-3 — CID 172516504
chlorogold;2-[2,6-di(propan-2-yl)phenyl]-N,N-dimethyl-3H-imidazo[1,5-a]pyridin-3-id-5-amine;phenylbenzene (PubChem CID 172516504) has the molecular formula C33H36AuClN3-3 and a molecular weight of 707.09 g/mol. Its IUPAC name is chlorogold;2-[2,6-di(propan-2-yl)phenyl]-N,N-dimethyl-3H-imidazo[1,5-a]pyridin-3-id-5-amine;phenylbenzene.
| Compound Name | chlorogold;2-[2,6-di(propan-2-yl)phenyl]-N,N-dimethyl-3H-imidazo[1,5-a]pyridin-3-id-5-amine;phenylbenzene |
|---|---|
| PubChem CID | 172516504 |
| Molecular Formula | C33H36AuClN3-3 |
| Molecular Weight | 707.09 g/mol |
| Exact Mass | 706.23 |
| IUPAC Name | chlorogold;2-[2,6-di(propan-2-yl)phenyl]-N,N-dimethyl-3H-imidazo[1,5-a]pyridin-3-id-5-amine;phenylbenzene |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C=C2C=CC=C(N(C)C)N2[CH-]1.Cl[Au].[c-]1ccccc1-c1[c-]cccc1 |
| InChI | InChI=1S/C21H28N3.C12H8.Au.ClH/c1-15(2)18-10-8-11-19(16(3)4)21(18)23-13-17-9-7-12-20(22(5)6)24(17)14-23;1-3-7-11(8-4-1)12-9-5-2-6-10-12;;/h7-16H,1-6H3;1-7,9H;;1H/q-1;-2;+1;/p-1 |
| InChIKey | HTJIQNJNZSGLRB-UHFFFAOYSA-M |
| XLogP | 8.63 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.09 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|