C21H29N3O2Se — CID 174053351
2-[2,6-di(propan-2-yl)phenyl]-3-hydroselenonyl-N,N-dimethyl-3H-imidazo[1,5-a]pyridin-5-amine (PubChem CID 174053351) has the molecular formula C21H29N3O2Se and a molecular weight of 434.44 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]-3-hydroselenonyl-N,N-dimethyl-3H-imidazo[1,5-a]pyridin-5-amine.
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]-3-hydroselenonyl-N,N-dimethyl-3H-imidazo[1,5-a]pyridin-5-amine |
|---|---|
| PubChem CID | 174053351 |
| Molecular Formula | C21H29N3O2Se |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]-3-hydroselenonyl-N,N-dimethyl-3H-imidazo[1,5-a]pyridin-5-amine |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C=C2C=CC=C(N(C)C)N2C1[SeH](=O)=O |
| InChI | InChI=1S/C21H29N3O2Se/c1-14(2)17-10-8-11-18(15(3)4)20(17)23-13-16-9-7-12-19(22(5)6)24(16)21(23)27(25)26/h7-15,21,27H,1-6H3 |
| InChIKey | XPAUYXXWIANHND-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|