C42H63N3 — CID 20681040
1,4,7-tris[2,6-di(propan-2-yl)phenyl]-1,4,7-triazonane (PubChem CID 20681040) has the molecular formula C42H63N3 and a molecular weight of 609.99 g/mol. Its IUPAC name is 1,4,7-tris[2,6-di(propan-2-yl)phenyl]-1,4,7-triazonane.
| Compound Name | 1,4,7-tris[2,6-di(propan-2-yl)phenyl]-1,4,7-triazonane |
|---|---|
| PubChem CID | 20681040 |
| Molecular Formula | C42H63N3 |
| Molecular Weight | 609.99 g/mol |
| Exact Mass | 609.50 |
| IUPAC Name | 1,4,7-tris[2,6-di(propan-2-yl)phenyl]-1,4,7-triazonane |
| SMILES | CC(C)c1cccc(C(C)C)c1N1CCN(c2c(C(C)C)cccc2C(C)C)CCN(c2c(C(C)C)cccc2C(C)C)CC1 |
| InChI | InChI=1S/C42H63N3/c1-28(2)34-16-13-17-35(29(3)4)40(34)43-22-24-44(41-36(30(5)6)18-14-19-37(41)31(7)8)26-27-45(25-23-43)42-38(32(9)10)20-15-21-39(42)33(11)12/h13-21,28-33H,22-27H2,1-12H3 |
| InChIKey | LVVATCNQHWDLST-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.99 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |