C26H39BN2 — CID 102596424
1,3-bis[2,6-di(propan-2-yl)phenyl]-1,3,2-diazaborolidine (PubChem CID 102596424) has the molecular formula C26H39BN2 and a molecular weight of 390.42 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]-1,3,2-diazaborolidine.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-1,3,2-diazaborolidine |
|---|---|
| PubChem CID | 102596424 |
| Molecular Formula | C26H39BN2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-1,3,2-diazaborolidine |
| SMILES | CC(C)c1cccc(C(C)C)c1N1BN(c2c(C(C)C)cccc2C(C)C)CC1 |
| InChI | InChI=1S/C26H39BN2/c1-17(2)21-11-9-12-22(18(3)4)25(21)28-15-16-29(27-28)26-23(19(5)6)13-10-14-24(26)20(7)8/h9-14,17-20,27H,15-16H2,1-8H3 |
| InChIKey | XRSOSRZZTHYIGI-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|