C36H54Cl3N3P3+3 — CID 101370288
2,4,6-trichloro-1,3,5-tris[2,6-di(propan-2-yl)phenyl]-1,3,5,2,4,6-triazatriphosphinane-2,4,6-triium (PubChem CID 101370288) has the molecular formula C36H54Cl3N3P3+3 and a molecular weight of 728.13 g/mol. Its IUPAC name is 2,4,6-trichloro-1,3,5-tris[2,6-di(propan-2-yl)phenyl]-1,3,5,2,4,6-triazatriphosphinane-2,4,6-triium.
| Compound Name | 2,4,6-trichloro-1,3,5-tris[2,6-di(propan-2-yl)phenyl]-1,3,5,2,4,6-triazatriphosphinane-2,4,6-triium |
|---|---|
| PubChem CID | 101370288 |
| Molecular Formula | C36H54Cl3N3P3+3 |
| Molecular Weight | 728.13 g/mol |
| Exact Mass | 726.26 |
| IUPAC Name | 2,4,6-trichloro-1,3,5-tris[2,6-di(propan-2-yl)phenyl]-1,3,5,2,4,6-triazatriphosphinane-2,4,6-triium |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[PH+](Cl)N(c2c(C(C)C)cccc2C(C)C)[PH+](Cl)N(c2c(C(C)C)cccc2C(C)C)[PH+]1Cl |
| InChI | InChI=1S/C36H51Cl3N3P3/c1-22(2)28-16-13-17-29(23(3)4)34(28)40-43(37)41(35-30(24(5)6)18-14-19-31(35)25(7)8)45(39)42(44(40)38)36-32(26(9)10)20-15-21-33(36)27(11)12/h13-27H,1-12H3/p+3 |
| InChIKey | CQFMJMAFFSUTRA-UHFFFAOYSA-Q |
| XLogP | 14.85 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.13 |
| LogP ≤ 5 | 14.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|