C24H36N2P2S2 — CID 122202965
1,3-bis[2,6-di(propan-2-yl)phenyl]-2,4-disulfido-1,3,2,4-diazadiphosphetidine-2,4-diium (PubChem CID 122202965) has the molecular formula C24H36N2P2S2 and a molecular weight of 478.65 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]-2,4-disulfido-1,3,2,4-diazadiphosphetidine-2,4-diium.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2,4-disulfido-1,3,2,4-diazadiphosphetidine-2,4-diium |
|---|---|
| PubChem CID | 122202965 |
| Molecular Formula | C24H36N2P2S2 |
| Molecular Weight | 478.65 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2,4-disulfido-1,3,2,4-diazadiphosphetidine-2,4-diium |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[PH+]([S-])N(c2c(C(C)C)cccc2C(C)C)[PH+]1[S-] |
| InChI | InChI=1S/C24H36N2P2S2/c1-15(2)19-11-9-12-20(16(3)4)23(19)25-27(29)26(28(25)30)24-21(17(5)6)13-10-14-22(24)18(7)8/h9-18,27-28H,1-8H3 |
| InChIKey | PPQBTFBCFIBDTQ-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.65 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|