C39H60Al3N3 — CID 16714946
1,3,5-tris[2,6-di(propan-2-yl)phenyl]-2,4,6-trimethyl-1,3,5,2,4,6-triazatrialuminane (PubChem CID 16714946) has the molecular formula C39H60Al3N3 and a molecular weight of 651.88 g/mol. Its IUPAC name is 1,3,5-tris[2,6-di(propan-2-yl)phenyl]-2,4,6-trimethyl-1,3,5,2,4,6-triazatrialuminane.
| Compound Name | 1,3,5-tris[2,6-di(propan-2-yl)phenyl]-2,4,6-trimethyl-1,3,5,2,4,6-triazatrialuminane |
|---|---|
| PubChem CID | 16714946 |
| Molecular Formula | C39H60Al3N3 |
| Molecular Weight | 651.88 g/mol |
| Exact Mass | 651.42 |
| IUPAC Name | 1,3,5-tris[2,6-di(propan-2-yl)phenyl]-2,4,6-trimethyl-1,3,5,2,4,6-triazatrialuminane |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[Al](C)N(c2c(C(C)C)cccc2C(C)C)[Al](C)N(c2c(C(C)C)cccc2C(C)C)[Al]1C |
| InChI | InChI=1S/3C12H17N.3CH3.3Al/c3*1-8(2)10-6-5-7-11(9(3)4)12(10)13;;;;;;/h3*5-9H,1-4H3;3*1H3;;; |
| InChIKey | NKYGOWBFHWPKRC-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.88 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |