C27H38N2OPd — CID 141164951
[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]palladium;hydrate (PubChem CID 141164951) has the molecular formula C27H38N2OPd and a molecular weight of 513.03 g/mol. Its IUPAC name is [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]palladium;hydrate.
| Compound Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]palladium;hydrate |
|---|---|
| PubChem CID | 141164951 |
| Molecular Formula | C27H38N2OPd |
| Molecular Weight | 513.03 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-2-ylidene]palladium;hydrate |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1ccn(-c2c(C(C)C)cccc2C(C)C)c1=[Pd].O |
| InChI | InChI=1S/C27H36N2.H2O.Pd/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;;/h9-16,18-21H,1-8H3;1H2; |
| InChIKey | BJUZTCZIOFVNCL-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 41.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.03 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |