C27H37GeN2+ — CID 139124493
CID 139124493 (PubChem CID 139124493) has the molecular formula C27H37GeN2+ and a molecular weight of 462.22 g/mol.
| Compound Name | CID 139124493 |
|---|---|
| PubChem CID | 139124493 |
| Molecular Formula | C27H37GeN2+ |
| Molecular Weight | 462.22 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1[GeH] |
| InChI | InChI=1S/C27H37GeN2/c1-17(2)21-11-9-12-22(18(3)4)25(21)29-15-16-30(27(29)28)26-23(19(5)6)13-10-14-24(26)20(7)8/h9-20,28H,1-8H3/q+1 |
| InChIKey | ZEGMJPQHCGJNNF-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.22 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|